C23H26Cl2N2O4S — CID 55557340
N-[2,6-dichloro-4-(3-cyclohexylpropanoylamino)phenyl]-4-methylsulfonylbenzamide (PubChem CID 55557340) has the molecular formula C23H26Cl2N2O4S and a molecular weight of 497.44 g/mol. Its IUPAC name is N-[2,6-dichloro-4-(3-cyclohexylpropanoylamino)phenyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[2,6-dichloro-4-(3-cyclohexylpropanoylamino)phenyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 55557340 |
| Molecular Formula | C23H26Cl2N2O4S |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | N-[2,6-dichloro-4-(3-cyclohexylpropanoylamino)phenyl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2c(Cl)cc(NC(=O)CCC3CCCCC3)cc2Cl)cc1 |
| InChI | InChI=1S/C23H26Cl2N2O4S/c1-32(30,31)18-10-8-16(9-11-18)23(29)27-22-19(24)13-17(14-20(22)25)26-21(28)12-7-15-5-3-2-4-6-15/h8-11,13-15H,2-7,12H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | OMUPMDBFHUECGD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |