C23H23N3O4 — CID 55639596
(E)-3-(2-cyanophenyl)-N-[4,5-dimethoxy-2-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 55639596) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is (E)-3-(2-cyanophenyl)-N-[4,5-dimethoxy-2-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-cyanophenyl)-N-[4,5-dimethoxy-2-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55639596 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (E)-3-(2-cyanophenyl)-N-[4,5-dimethoxy-2-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/c2ccccc2C#N)c(C(=O)N2CCCC2)cc1OC |
| InChI | InChI=1S/C23H23N3O4/c1-29-20-13-18(23(28)26-11-5-6-12-26)19(14-21(20)30-2)25-22(27)10-9-16-7-3-4-8-17(16)15-24/h3-4,7-10,13-14H,5-6,11-12H2,1-2H3,(H,25,27)/b10-9+ |
| InChIKey | NYDHLPPIEATIHC-MDZDMXLPSA-N |
| XLogP | 3.46 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|