C24H27N3O4S2 — CID 55649375
propan-2-yl 3-(4-methylphenyl)-3-[[2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]propanoate (PubChem CID 55649375) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is propan-2-yl 3-(4-methylphenyl)-3-[[2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]propanoate.
| Compound Name | propan-2-yl 3-(4-methylphenyl)-3-[[2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 55649375 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | propan-2-yl 3-(4-methylphenyl)-3-[[2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]propanoate |
| SMILES | Cc1ccc(C(CC(=O)OC(C)C)NC(=O)Cc2csc(NC(=O)Cc3cccs3)n2)cc1 |
| InChI | InChI=1S/C24H27N3O4S2/c1-15(2)31-23(30)13-20(17-8-6-16(3)7-9-17)26-21(28)11-18-14-33-24(25-18)27-22(29)12-19-5-4-10-32-19/h4-10,14-15,20H,11-13H2,1-3H3,(H,26,28)(H,25,27,29) |
| InChIKey | FLEGYOCWTLLPDL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|