C22H24N4O5S — CID 55650310
ethyl 5-methyl-1-[4-[1-(3-sulfamoylphenyl)ethylcarbamoyl]phenyl]pyrazole-4-carboxylate (PubChem CID 55650310) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is ethyl 5-methyl-1-[4-[1-(3-sulfamoylphenyl)ethylcarbamoyl]phenyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-1-[4-[1-(3-sulfamoylphenyl)ethylcarbamoyl]phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 55650310 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | ethyl 5-methyl-1-[4-[1-(3-sulfamoylphenyl)ethylcarbamoyl]phenyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(C(=O)NC(C)c3cccc(S(N)(=O)=O)c3)cc2)c1C |
| InChI | InChI=1S/C22H24N4O5S/c1-4-31-22(28)20-13-24-26(15(20)3)18-10-8-16(9-11-18)21(27)25-14(2)17-6-5-7-19(12-17)32(23,29)30/h5-14H,4H2,1-3H3,(H,25,27)(H2,23,29,30) |
| InChIKey | ZSLHMXGMWUERHO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |