C22H33N7O3S — CID 55653225
[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone (PubChem CID 55653225) has the molecular formula C22H33N7O3S and a molecular weight of 475.62 g/mol. Its IUPAC name is [4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone.
| Compound Name | [4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone |
|---|---|
| PubChem CID | 55653225 |
| Molecular Formula | C22H33N7O3S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | [4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN(S(=O)(=O)N3CCN(C)CC3)CC2)c2nc3n(c2n1)CCCCC3 |
| InChI | InChI=1S/C22H33N7O3S/c1-17-16-18(20-21(23-17)29-7-5-3-4-6-19(29)24-20)22(30)26-10-14-28(15-11-26)33(31,32)27-12-8-25(2)9-13-27/h16H,3-15H2,1-2H3 |
| InChIKey | GGXGPBXLWNECNR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 94.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |