C20H21N3O3S2 — CID 55663040
5-(4-methylphenyl)-3-[(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 55663040) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 5-(4-methylphenyl)-3-[(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(4-methylphenyl)-3-[(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 55663040 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 5-(4-methylphenyl)-3-[(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1ccc(-c2nn(CN3CCCc4cc(S(C)(=O)=O)ccc43)c(=S)o2)cc1 |
| InChI | InChI=1S/C20H21N3O3S2/c1-14-5-7-15(8-6-14)19-21-23(20(27)26-19)13-22-11-3-4-16-12-17(28(2,24)25)9-10-18(16)22/h5-10,12H,3-4,11,13H2,1-2H3 |
| InChIKey | MTVWJIMTPOQNOW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|