C19H26ClN3O6S2 — CID 55666487
5-(tert-butylsulfamoyl)-N-[4-chloro-3-(diethylsulfamoyl)phenyl]furan-2-carboxamide (PubChem CID 55666487) has the molecular formula C19H26ClN3O6S2 and a molecular weight of 492.02 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-[4-chloro-3-(diethylsulfamoyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-[4-chloro-3-(diethylsulfamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55666487 |
| Molecular Formula | C19H26ClN3O6S2 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-[4-chloro-3-(diethylsulfamoyl)phenyl]furan-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)c2ccc(S(=O)(=O)NC(C)(C)C)o2)ccc1Cl |
| InChI | InChI=1S/C19H26ClN3O6S2/c1-6-23(7-2)31(27,28)16-12-13(8-9-14(16)20)21-18(24)15-10-11-17(29-15)30(25,26)22-19(3,4)5/h8-12,22H,6-7H2,1-5H3,(H,21,24) |
| InChIKey | NAVGOXAVNFTASI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |