C22H19N3O3 — CID 55668469
N'-(2-naphthalen-1-ylacetyl)-3-phenyl-4,5-dihydro-1,2-oxazole-5-carbohydrazide (PubChem CID 55668469) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is N'-(2-naphthalen-1-ylacetyl)-3-phenyl-4,5-dihydro-1,2-oxazole-5-carbohydrazide.
| Compound Name | N'-(2-naphthalen-1-ylacetyl)-3-phenyl-4,5-dihydro-1,2-oxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55668469 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N'-(2-naphthalen-1-ylacetyl)-3-phenyl-4,5-dihydro-1,2-oxazole-5-carbohydrazide |
| SMILES | O=C(Cc1cccc2ccccc12)NNC(=O)C1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C22H19N3O3/c26-21(13-17-11-6-10-15-7-4-5-12-18(15)17)23-24-22(27)20-14-19(25-28-20)16-8-2-1-3-9-16/h1-12,20H,13-14H2,(H,23,26)(H,24,27) |
| InChIKey | GRHHTCNFSXECSW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|