C18H21N5O6S — CID 55821277
1-[2-[4-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione (PubChem CID 55821277) has the molecular formula C18H21N5O6S and a molecular weight of 435.46 g/mol. Its IUPAC name is 1-[2-[4-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 55821277 |
| Molecular Formula | C18H21N5O6S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 1-[2-[4-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
| SMILES | O=C(CN1C(=O)CCC1=O)N1CCN(C(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)CC1 |
| InChI | InChI=1S/C18H21N5O6S/c24-15-3-4-16(25)23(15)12-17(26)20-5-7-21(8-6-20)18(27)13-1-2-14-19-30(28,29)10-9-22(14)11-13/h1-2,11H,3-10,12H2 |
| InChIKey | KGXILDDAGAOMIB-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 127.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|