C25H20N6O3 — CID 55913517
2-(furan-2-yl)-N'-[5-methyl-1-(3-methylphenyl)triazole-4-carbonyl]quinoline-4-carbohydrazide (PubChem CID 55913517) has the molecular formula C25H20N6O3 and a molecular weight of 452.47 g/mol. Its IUPAC name is 2-(furan-2-yl)-N'-[5-methyl-1-(3-methylphenyl)triazole-4-carbonyl]quinoline-4-carbohydrazide.
| Compound Name | 2-(furan-2-yl)-N'-[5-methyl-1-(3-methylphenyl)triazole-4-carbonyl]quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 55913517 |
| Molecular Formula | C25H20N6O3 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 2-(furan-2-yl)-N'-[5-methyl-1-(3-methylphenyl)triazole-4-carbonyl]quinoline-4-carbohydrazide |
| SMILES | Cc1cccc(-n2nnc(C(=O)NNC(=O)c3cc(-c4ccco4)nc4ccccc34)c2C)c1 |
| InChI | InChI=1S/C25H20N6O3/c1-15-7-5-8-17(13-15)31-16(2)23(27-30-31)25(33)29-28-24(32)19-14-21(22-11-6-12-34-22)26-20-10-4-3-9-18(19)20/h3-14H,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | CCDAOSWPEXZXED-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|