C19H20N4O6S — CID 55941475
N-[4-[[(2S)-1-(6-nitro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]sulfamoyl]phenyl]acetamide (PubChem CID 55941475) has the molecular formula C19H20N4O6S and a molecular weight of 432.46 g/mol. Its IUPAC name is N-[4-[[(2S)-1-(6-nitro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(2S)-1-(6-nitro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 55941475 |
| Molecular Formula | C19H20N4O6S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-[4-[[(2S)-1-(6-nitro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H](C)C(=O)N2CCc3ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C19H20N4O6S/c1-12(21-30(28,29)17-7-4-15(5-8-17)20-13(2)24)19(25)22-10-9-14-3-6-16(23(26)27)11-18(14)22/h3-8,11-12,21H,9-10H2,1-2H3,(H,20,24)/t12-/m0/s1 |
| InChIKey | CBUJJFIHDLIEDL-LBPRGKRZSA-N |
| XLogP | 1.81 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|