C30H24N4O3 — CID 55961878
3-benzylidene-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-1,2-dihydrocyclopenta[b]quinoline-9-carboxamide (PubChem CID 55961878) has the molecular formula C30H24N4O3 and a molecular weight of 488.55 g/mol. Its IUPAC name is 3-benzylidene-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-1,2-dihydrocyclopenta[b]quinoline-9-carboxamide.
| Compound Name | 3-benzylidene-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-1,2-dihydrocyclopenta[b]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 55961878 |
| Molecular Formula | C30H24N4O3 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 3-benzylidene-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-1,2-dihydrocyclopenta[b]quinoline-9-carboxamide |
| SMILES | CC1(c2cccc(NC(=O)c3c4c(nc5ccccc35)C(=Cc3ccccc3)CC4)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C30H24N4O3/c1-30(28(36)33-29(37)34-30)20-10-7-11-21(17-20)31-27(35)25-22-12-5-6-13-24(22)32-26-19(14-15-23(25)26)16-18-8-3-2-4-9-18/h2-13,16-17H,14-15H2,1H3,(H,31,35)(H2,33,34,36,37) |
| InChIKey | JLNDXNPEFXNFMQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|