C23H26N4O4S2 — CID 55993724
N-[3-[(Z)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide (PubChem CID 55993724) has the molecular formula C23H26N4O4S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is N-[3-[(Z)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide.
| Compound Name | N-[3-[(Z)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
|---|---|
| PubChem CID | 55993724 |
| Molecular Formula | C23H26N4O4S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | N-[3-[(Z)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
| SMILES | CN1CCCCC/C1=N/S(=O)(=O)c1cccc(NC(=O)CC2Sc3ccccc3NC2=O)c1 |
| InChI | InChI=1S/C23H26N4O4S2/c1-27-13-6-2-3-12-21(27)26-33(30,31)17-9-7-8-16(14-17)24-22(28)15-20-23(29)25-18-10-4-5-11-19(18)32-20/h4-5,7-11,14,20H,2-3,6,12-13,15H2,1H3,(H,24,28)(H,25,29)/b26-21- |
| InChIKey | VCMVKGKOERYQGW-QLYXXIJNSA-N |
| XLogP | 3.72 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|