C22H18N6O3S — CID 55997438
3-nitro-4-(1-pyridin-2-ylethylamino)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 55997438) has the molecular formula C22H18N6O3S and a molecular weight of 446.49 g/mol. Its IUPAC name is 3-nitro-4-(1-pyridin-2-ylethylamino)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-nitro-4-(1-pyridin-2-ylethylamino)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55997438 |
| Molecular Formula | C22H18N6O3S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 3-nitro-4-(1-pyridin-2-ylethylamino)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CC(Nc1ccc(C(=O)Nc2nc(-c3cccnc3)cs2)cc1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C22H18N6O3S/c1-14(17-6-2-3-10-24-17)25-18-8-7-15(11-20(18)28(30)31)21(29)27-22-26-19(13-32-22)16-5-4-9-23-12-16/h2-14,25H,1H3,(H,26,27,29) |
| InChIKey | XXBCHTNUXDRIAJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|