About N-butan-2-ylnitramide
N-butan-2-ylnitramide (PubChem CID 560605) has the molecular formula C4H10N2O2
and a molecular weight of 118.14 g/mol. Its IUPAC name is N-butan-2-ylnitramide.
Molecular Properties
| Compound Name | N-butan-2-ylnitramide |
| PubChem CID | 560605 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | N-butan-2-ylnitramide |
| SMILES | CCC(C)N[N+](=O)[O-] |
| InChI | InChI=1S/C4H10N2O2/c1-3-4(2)5-6(7)8/h4-5H,3H2,1-2H3 |
| InChIKey | KKMFWKMPXZYQIV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-ylnitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-ylnitramide?
The IUPAC name of N-butan-2-ylnitramide (CID 560605) is N-butan-2-ylnitramide.
What is the SMILES notation for N-butan-2-ylnitramide?
The canonical SMILES for N-butan-2-ylnitramide is CCC(C)N[N+](=O)[O-].
What is the InChIKey of N-butan-2-ylnitramide?
The InChIKey is KKMFWKMPXZYQIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2/c1-3-4(2)5-6(7)8/h4-5H,3H2,1-2H3.
What are the key properties of N-butan-2-ylnitramide?
N-butan-2-ylnitramide has a molecular weight of 118.14 g/mol, XLogP of 0.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-ylnitramide is sourced from PubChem (CID 560605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).