C19H21N3O5S — CID 56506321
N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenylacetyl]-2-hydroxybenzohydrazide (PubChem CID 56506321) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenylacetyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenylacetyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 56506321 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenylacetyl]-2-hydroxybenzohydrazide |
| SMILES | O=C(NNC(=O)C(c1ccccc1)N1CCS(=O)(=O)CC1)c1ccccc1O |
| InChI | InChI=1S/C19H21N3O5S/c23-16-9-5-4-8-15(16)18(24)20-21-19(25)17(14-6-2-1-3-7-14)22-10-12-28(26,27)13-11-22/h1-9,17,23H,10-13H2,(H,20,24)(H,21,25) |
| InChIKey | AJPCLCVYHVOEBO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|