C21H26N4O4S — CID 56574883
2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-[2-(4-methylanilino)acetyl]-2-phenylacetohydrazide (PubChem CID 56574883) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-[2-(4-methylanilino)acetyl]-2-phenylacetohydrazide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-[2-(4-methylanilino)acetyl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 56574883 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-[2-(4-methylanilino)acetyl]-2-phenylacetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)C(c2ccccc2)N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O4S/c1-16-7-9-18(10-8-16)22-15-19(26)23-24-21(27)20(17-5-3-2-4-6-17)25-11-13-30(28,29)14-12-25/h2-10,20,22H,11-15H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | ORBUWNVDGLPYCD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|