C18H18F3N3O3S — CID 56577436
2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N'-(2,3,4-trifluorophenyl)acetohydrazide (PubChem CID 56577436) has the molecular formula C18H18F3N3O3S and a molecular weight of 413.42 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N'-(2,3,4-trifluorophenyl)acetohydrazide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N'-(2,3,4-trifluorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 56577436 |
| Molecular Formula | C18H18F3N3O3S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N'-(2,3,4-trifluorophenyl)acetohydrazide |
| SMILES | O=C(NNc1ccc(F)c(F)c1F)C(c1ccccc1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C18H18F3N3O3S/c19-13-6-7-14(16(21)15(13)20)22-23-18(25)17(12-4-2-1-3-5-12)24-8-10-28(26,27)11-9-24/h1-7,17,22H,8-11H2,(H,23,25) |
| InChIKey | SAVXJHGSZYXSTG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|