C18H15N3O4S — CID 56575284
N-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]-6-nitro-1,3-benzothiazol-2-amine (PubChem CID 56575284) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is N-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]-6-nitro-1,3-benzothiazol-2-amine.
| Compound Name | N-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]-6-nitro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 56575284 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]-6-nitro-1,3-benzothiazol-2-amine |
| SMILES | COc1cccc2cc(C(C)Nc3nc4ccc([N+](=O)[O-])cc4s3)oc12 |
| InChI | InChI=1S/C18H15N3O4S/c1-10(15-8-11-4-3-5-14(24-2)17(11)25-15)19-18-20-13-7-6-12(21(22)23)9-16(13)26-18/h3-10H,1-2H3,(H,19,20) |
| InChIKey | YWFFBBXGRNYJIU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|