C16H18N6O3S3 — CID 56582024
N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 56582024) has the molecular formula C16H18N6O3S3 and a molecular weight of 438.56 g/mol. Its IUPAC name is N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 56582024 |
| Molecular Formula | C16H18N6O3S3 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | CCn1c(CCNC(=O)c2ccc3c(c2)SC2=NS(=O)(=O)CCN23)n[nH]c1=S |
| InChI | InChI=1S/C16H18N6O3S3/c1-2-21-13(18-19-15(21)26)5-6-17-14(23)10-3-4-11-12(9-10)27-16-20-28(24,25)8-7-22(11)16/h3-4,9H,2,5-8H2,1H3,(H,17,23)(H,19,26) |
| InChIKey | HQVJMCLFPZGSDW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 112.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|