C23H32N2O6 — CID 56598706
N-[2-[[3-[4-(2-ethoxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]-2-(3-hydroxyphenyl)acetamide (PubChem CID 56598706) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[2-[[3-[4-(2-ethoxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]-2-(3-hydroxyphenyl)acetamide.
| Compound Name | N-[2-[[3-[4-(2-ethoxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]-2-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 56598706 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | N-[2-[[3-[4-(2-ethoxyethoxy)phenoxy]-2-hydroxypropyl]amino]ethyl]-2-(3-hydroxyphenyl)acetamide |
| SMILES | CCOCCOc1ccc(OCC(O)CNCCNC(=O)Cc2cccc(O)c2)cc1 |
| InChI | InChI=1S/C23H32N2O6/c1-2-29-12-13-30-21-6-8-22(9-7-21)31-17-20(27)16-24-10-11-25-23(28)15-18-4-3-5-19(26)14-18/h3-9,14,20,24,26-27H,2,10-13,15-17H2,1H3,(H,25,28) |
| InChIKey | YORDXIMYFRVFOB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 109.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|