C23H32N2O6 — CID 66653064
4-[[3-[4-(2-ethoxyethoxy)phenoxy]-2-hydroxypropyl]amino]-2-(2-hydroxyphenyl)butanamide (PubChem CID 66653064) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is 4-[[3-[4-(2-ethoxyethoxy)phenoxy]-2-hydroxypropyl]amino]-2-(2-hydroxyphenyl)butanamide.
| Compound Name | 4-[[3-[4-(2-ethoxyethoxy)phenoxy]-2-hydroxypropyl]amino]-2-(2-hydroxyphenyl)butanamide |
|---|---|
| PubChem CID | 66653064 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 4-[[3-[4-(2-ethoxyethoxy)phenoxy]-2-hydroxypropyl]amino]-2-(2-hydroxyphenyl)butanamide |
| SMILES | CCOCCOc1ccc(OCC(O)CNCCC(C(N)=O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C23H32N2O6/c1-2-29-13-14-30-18-7-9-19(10-8-18)31-16-17(26)15-25-12-11-21(23(24)28)20-5-3-4-6-22(20)27/h3-10,17,21,25-27H,2,11-16H2,1H3,(H2,24,28) |
| InChIKey | FYCMOWSMDROVHH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|