C28H31N2O2S2+ — CID 56599814
1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid (PubChem CID 56599814) has the molecular formula C28H31N2O2S2+ and a molecular weight of 491.70 g/mol. Its IUPAC name is 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid.
| Compound Name | 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 56599814 |
| Molecular Formula | C28H31N2O2S2+ |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid |
| SMILES | CCN1C(c2ccccc2)=[N+](CC)C(c2ccc(SC)cc2)C1(C(=O)O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C28H30N2O2S2/c1-5-29-25(20-12-16-23(33-3)17-13-20)28(27(31)32,22-14-18-24(34-4)19-15-22)30(6-2)26(29)21-10-8-7-9-11-21/h7-19,25H,5-6H2,1-4H3/p+1 |
| InChIKey | GZMCGGKKQMSGQL-UHFFFAOYSA-O |
| XLogP | 5.97 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|