C14H21NO — CID 56600815
(1R,4R,5R,7R,8R)-5,7,10-trimethyl-12-azatricyclo[6.3.1.04,12]dodec-10-en-6-one (PubChem CID 56600815) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (1R,4R,5R,7R,8R)-5,7,10-trimethyl-12-azatricyclo[6.3.1.04,12]dodec-10-en-6-one.
| Compound Name | (1R,4R,5R,7R,8R)-5,7,10-trimethyl-12-azatricyclo[6.3.1.04,12]dodec-10-en-6-one |
|---|---|
| PubChem CID | 56600815 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (1R,4R,5R,7R,8R)-5,7,10-trimethyl-12-azatricyclo[6.3.1.04,12]dodec-10-en-6-one |
| SMILES | CC1=C[C@H]2CC[C@@H]3[C@@H](C)C(=O)[C@H](C)[C@@H](C1)N32 |
| InChI | InChI=1S/C14H21NO/c1-8-6-11-4-5-12-9(2)14(16)10(3)13(7-8)15(11)12/h6,9-13H,4-5,7H2,1-3H3/t9-,10-,11-,12-,13-/m1/s1 |
| InChIKey | DIHMROLOHJSGGD-SYLRKERUSA-N |
| XLogP | 2.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|