C8H8OS — CID 56609471
2,7-dihydrothiopyrano[4,3-b]pyran (PubChem CID 56609471) has the molecular formula C8H8OS and a molecular weight of 152.22 g/mol. Its IUPAC name is 2,7-dihydrothiopyrano[4,3-b]pyran.
| Compound Name | 2,7-dihydrothiopyrano[4,3-b]pyran |
|---|---|
| PubChem CID | 56609471 |
| Molecular Formula | C8H8OS |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 2,7-dihydrothiopyrano[4,3-b]pyran |
| SMILES | C1=CC2=CSCC=C2OC1 |
| InChI | InChI=1S/C8H8OS/c1-2-7-6-10-5-3-8(7)9-4-1/h1-3,6H,4-5H2 |
| InChIKey | IUENQDBBPWKQNZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |