About 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone
1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone (PubChem CID 56615143) has the molecular formula C6H10O2S
and a molecular weight of 146.21 g/mol. Its IUPAC name is 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone.
Molecular Properties
| Compound Name | 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone |
| PubChem CID | 56615143 |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone |
| SMILES | CC=S(C(C)=O)C(C)=O |
| InChI | InChI=1S/C6H10O2S/c1-4-9(5(2)7)6(3)8/h4H,1-3H3 |
| InChIKey | KVTSOOLBKXXEBC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone?
The IUPAC name of 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone (CID 56615143) is 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone.
What is the SMILES notation for 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone?
The canonical SMILES for 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone is CC=S(C(C)=O)C(C)=O.
What is the InChIKey of 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone?
The InChIKey is KVTSOOLBKXXEBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S/c1-4-9(5(2)7)6(3)8/h4H,1-3H3.
What are the key properties of 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone?
1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone has a molecular weight of 146.21 g/mol, XLogP of 1.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[acetyl(ethylidene)-λ4-sulfanyl]ethanone is sourced from PubChem (CID 56615143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).