C25H36O4 — CID 56626389
(7S,10S,11S,14R,19S)-6,11,19-trimethyl-2,5,22,25-tetraoxahexacyclo[16.7.1.01,21.07,11.010,15.014,19]hexacosa-15,17-diene (PubChem CID 56626389) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is (7S,10S,11S,14R,19S)-6,11,19-trimethyl-2,5,22,25-tetraoxahexacyclo[16.7.1.01,21.07,11.010,15.014,19]hexacosa-15,17-diene.
| Compound Name | (7S,10S,11S,14R,19S)-6,11,19-trimethyl-2,5,22,25-tetraoxahexacyclo[16.7.1.01,21.07,11.010,15.014,19]hexacosa-15,17-diene |
|---|---|
| PubChem CID | 56626389 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | (7S,10S,11S,14R,19S)-6,11,19-trimethyl-2,5,22,25-tetraoxahexacyclo[16.7.1.01,21.07,11.010,15.014,19]hexacosa-15,17-diene |
| SMILES | CC1OCCOC23CC4=CC=C5[C@H]6CC[C@H]1[C@@]6(C)CC[C@H]5[C@]4(C)CC2OCCO3 |
| InChI | InChI=1S/C25H36O4/c1-16-19-6-7-20-18-5-4-17-14-25(28-12-10-26-16)22(27-11-13-29-25)15-24(17,3)21(18)8-9-23(19,20)2/h4-5,16,19-22H,6-15H2,1-3H3/t16?,19-,20-,21-,22?,23-,24-,25?/m1/s1 |
| InChIKey | WLPXTLQSMIUQNS-BSYMOJECSA-N |
| XLogP | 4.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |