C18H22O3 — CID 56629156
(3aS,4R,5R,6aR)-5-hydroxy-4-(4-phenylbutanoyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 56629156) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (3aS,4R,5R,6aR)-5-hydroxy-4-(4-phenylbutanoyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aS,4R,5R,6aR)-5-hydroxy-4-(4-phenylbutanoyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 56629156 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (3aS,4R,5R,6aR)-5-hydroxy-4-(4-phenylbutanoyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | O=C1C[C@H]2C[C@@H](O)[C@H](C(=O)CCCc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C18H22O3/c19-14-9-13-10-17(21)18(15(13)11-14)16(20)8-4-7-12-5-2-1-3-6-12/h1-3,5-6,13,15,17-18,21H,4,7-11H2/t13-,15-,17+,18-/m0/s1 |
| InChIKey | GUDLMBGPSFUUPK-PLYYQAHHSA-N |
| XLogP | 2.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |