C11H13N9O6S3 — CID 56634630
(2S,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(1-methyltetrazol-5-yl)sulfanyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 56634630) has the molecular formula C11H13N9O6S3 and a molecular weight of 463.48 g/mol. Its IUPAC name is (2S,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(1-methyltetrazol-5-yl)sulfanyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(1-methyltetrazol-5-yl)sulfanyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 56634630 |
| Molecular Formula | C11H13N9O6S3 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | (2S,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(1-methyltetrazol-5-yl)sulfanyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N(S(=O)(=O)O)[C@H]1Sc1nnnn1C)c1csc(N)n1 |
| InChI | InChI=1S/C11H13N9O6S3/c1-19-11(15-17-18-19)28-9-6(8(22)20(9)29(23,24)25)14-7(21)5(16-26-2)4-3-27-10(12)13-4/h3,6,9H,1-2H3,(H2,12,13)(H,14,21)(H,23,24,25)/t6-,9+/m1/s1 |
| InChIKey | UPUBKXQYXUGAMN-MUWHJKNJSA-N |
| XLogP | -2.15 |
| TPSA | 207.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|