C11H23N3O — CID 56635405
4-(3,5-dimethylpiperazin-2-yl)-2-methylmorpholine (PubChem CID 56635405) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperazin-2-yl)-2-methylmorpholine.
| Compound Name | 4-(3,5-dimethylpiperazin-2-yl)-2-methylmorpholine |
|---|---|
| PubChem CID | 56635405 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 4-(3,5-dimethylpiperazin-2-yl)-2-methylmorpholine |
| SMILES | CC1CNC(N2CCOC(C)C2)C(C)N1 |
| InChI | InChI=1S/C11H23N3O/c1-8-6-12-11(10(3)13-8)14-4-5-15-9(2)7-14/h8-13H,4-7H2,1-3H3 |
| InChIKey | WQNDXAUEROUPDE-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |