C19H27NO4Si — CID 56640935
[(1S)-1-[dimethyl(phenyl)silyl]but-2-ynyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 56640935) has the molecular formula C19H27NO4Si and a molecular weight of 361.51 g/mol. Its IUPAC name is [(1S)-1-[dimethyl(phenyl)silyl]but-2-ynyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [(1S)-1-[dimethyl(phenyl)silyl]but-2-ynyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 56640935 |
| Molecular Formula | C19H27NO4Si |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [(1S)-1-[dimethyl(phenyl)silyl]but-2-ynyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC#C[C@@H](OC(=O)CNC(=O)OC(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H27NO4Si/c1-7-11-17(25(5,6)15-12-9-8-10-13-15)23-16(21)14-20-18(22)24-19(2,3)4/h8-10,12-13,17H,14H2,1-6H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | PNCBVMYCXATTSU-KRWDZBQOSA-N |
| XLogP | 2.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|