C15H25NO2 — CID 566440
13-butyl-8-oxa-6-azatricyclo[7.3.1.01,6]tridecan-7-one (PubChem CID 566440) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 13-butyl-8-oxa-6-azatricyclo[7.3.1.01,6]tridecan-7-one.
| Compound Name | 13-butyl-8-oxa-6-azatricyclo[7.3.1.01,6]tridecan-7-one |
|---|---|
| PubChem CID | 566440 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 13-butyl-8-oxa-6-azatricyclo[7.3.1.01,6]tridecan-7-one |
| SMILES | CCCCC1C2CCCC13CCCCN3C(=O)O2 |
| InChI | InChI=1S/C15H25NO2/c1-2-3-7-12-13-8-6-10-15(12)9-4-5-11-16(15)14(17)18-13/h12-13H,2-11H2,1H3 |
| InChIKey | QTHRVFGWDWQHEI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |