C12H16BNO5S — CID 56649692
View drug profile → vaborbactam2-[(3R,6S)-2-hydroxy-3-[(2-thiophen-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid (PubChem CID 56649692) has the molecular formula C12H16BNO5S and a molecular weight of 297.14 g/mol. Its IUPAC name is 2-[(3R,6S)-2-hydroxy-3-[(2-thiophen-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid.
| Compound Name | 2-[(3R,6S)-2-hydroxy-3-[(2-thiophen-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid |
|---|---|
| PubChem CID | 56649692 |
| Molecular Formula | C12H16BNO5S |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-[(3R,6S)-2-hydroxy-3-[(2-thiophen-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CC[C@H](NC(=O)Cc2cccs2)B(O)O1 |
| InChI | InChI=1S/C12H16BNO5S/c15-11(7-9-2-1-5-20-9)14-10-4-3-8(6-12(16)17)19-13(10)18/h1-2,5,8,10,18H,3-4,6-7H2,(H,14,15)(H,16,17)/t8-,10-/m0/s1 |
| InChIKey | IOOWNWLVCOUUEX-WPRPVWTQSA-N |
| XLogP | 0.45 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|