C5H12BrNZn — CID 56652850
bromozinc(1+);N,N-dimethylpropan-1-amine (PubChem CID 56652850) has the molecular formula C5H12BrNZn and a molecular weight of 231.45 g/mol. Its IUPAC name is bromozinc(1+);N,N-dimethylpropan-1-amine.
| Compound Name | bromozinc(1+);N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 56652850 |
| Molecular Formula | C5H12BrNZn |
| Molecular Weight | 231.45 g/mol |
| Exact Mass | 228.94 |
| IUPAC Name | bromozinc(1+);N,N-dimethylpropan-1-amine |
| SMILES | [CH2-]CCN(C)C.[Zn+]Br |
| InChI | InChI=1S/C5H12N.BrH.Zn/c1-4-5-6(2)3;;/h1,4-5H2,2-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | IBJUOSWBYUXGAN-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|