C20H25N5O3 — CID 56654014
(3aR)-3-[(6-aminopurin-9-yl)methyl]-3a-hydroxy-5a,9-dimethyl-4,5,6,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-2-one (PubChem CID 56654014) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is (3aR)-3-[(6-aminopurin-9-yl)methyl]-3a-hydroxy-5a,9-dimethyl-4,5,6,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-2-one.
| Compound Name | (3aR)-3-[(6-aminopurin-9-yl)methyl]-3a-hydroxy-5a,9-dimethyl-4,5,6,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 56654014 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (3aR)-3-[(6-aminopurin-9-yl)methyl]-3a-hydroxy-5a,9-dimethyl-4,5,6,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-2-one |
| SMILES | CC1=C2C3OC(=O)C(Cn4cnc5c(N)ncnc54)[C@]3(O)CCC2(C)CCC1 |
| InChI | InChI=1S/C20H25N5O3/c1-11-4-3-5-19(2)6-7-20(27)12(18(26)28-15(20)13(11)19)8-25-10-24-14-16(21)22-9-23-17(14)25/h9-10,12,15,27H,3-8H2,1-2H3,(H2,21,22,23)/t12?,15?,19?,20-/m1/s1 |
| InChIKey | CGEFTVMNBWUBPA-VXSQYABASA-N |
| XLogP | 1.98 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|