C20H19F3N6OS — CID 56689413
2-(1,3-benzothiazol-2-yl)-5-ethyl-4-(3-imidazol-1-ylpropylamino)-6-(trifluoromethyl)pyridazin-3-one (PubChem CID 56689413) has the molecular formula C20H19F3N6OS and a molecular weight of 448.47 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-5-ethyl-4-(3-imidazol-1-ylpropylamino)-6-(trifluoromethyl)pyridazin-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-5-ethyl-4-(3-imidazol-1-ylpropylamino)-6-(trifluoromethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 56689413 |
| Molecular Formula | C20H19F3N6OS |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-5-ethyl-4-(3-imidazol-1-ylpropylamino)-6-(trifluoromethyl)pyridazin-3-one |
| SMILES | CCc1c(C(F)(F)F)nn(-c2nc3ccccc3s2)c(=O)c1NCCCn1ccnc1 |
| InChI | InChI=1S/C20H19F3N6OS/c1-2-13-16(25-8-5-10-28-11-9-24-12-28)18(30)29(27-17(13)20(21,22)23)19-26-14-6-3-4-7-15(14)31-19/h3-4,6-7,9,11-12,25H,2,5,8,10H2,1H3 |
| InChIKey | LBZNFALLZDFIFF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|