C19H22Cl2O3 — CID 56694906
(1',1'-dichloro-7,7-dimethylspiro[bicyclo[4.1.0]heptane-4,2'-cyclopropane]-3-yl) 2-phenoxyacetate (PubChem CID 56694906) has the molecular formula C19H22Cl2O3 and a molecular weight of 369.29 g/mol. Its IUPAC name is (1',1'-dichloro-7,7-dimethylspiro[bicyclo[4.1.0]heptane-4,2'-cyclopropane]-3-yl) 2-phenoxyacetate.
| Compound Name | (1',1'-dichloro-7,7-dimethylspiro[bicyclo[4.1.0]heptane-4,2'-cyclopropane]-3-yl) 2-phenoxyacetate |
|---|---|
| PubChem CID | 56694906 |
| Molecular Formula | C19H22Cl2O3 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (1',1'-dichloro-7,7-dimethylspiro[bicyclo[4.1.0]heptane-4,2'-cyclopropane]-3-yl) 2-phenoxyacetate |
| SMILES | CC1(C)C2CC(OC(=O)COc3ccccc3)C3(CC21)CC3(Cl)Cl |
| InChI | InChI=1S/C19H22Cl2O3/c1-17(2)13-8-15(18(9-14(13)17)11-19(18,20)21)24-16(22)10-23-12-6-4-3-5-7-12/h3-7,13-15H,8-11H2,1-2H3 |
| InChIKey | LUPQDABWDNMBGR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|