C16H16F3N3O3S — CID 56697615
methyl 3,3,3-trifluoro-2-[(3-methylbenzoyl)amino]-2-[(4-methyl-1,3-thiazol-2-yl)amino]propanoate (PubChem CID 56697615) has the molecular formula C16H16F3N3O3S and a molecular weight of 387.38 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-[(3-methylbenzoyl)amino]-2-[(4-methyl-1,3-thiazol-2-yl)amino]propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-[(3-methylbenzoyl)amino]-2-[(4-methyl-1,3-thiazol-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 56697615 |
| Molecular Formula | C16H16F3N3O3S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-[(3-methylbenzoyl)amino]-2-[(4-methyl-1,3-thiazol-2-yl)amino]propanoate |
| SMILES | COC(=O)C(NC(=O)c1cccc(C)c1)(Nc1nc(C)cs1)C(F)(F)F |
| InChI | InChI=1S/C16H16F3N3O3S/c1-9-5-4-6-11(7-9)12(23)21-15(13(24)25-3,16(17,18)19)22-14-20-10(2)8-26-14/h4-8H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | IJDBINNVFBGZFM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|