C14H11F4N3O3S — CID 7300840
methyl (2S)-3,3,3-trifluoro-2-[(4-fluorobenzoyl)amino]-2-(1,3-thiazol-2-ylamino)propanoate (PubChem CID 7300840) has the molecular formula C14H11F4N3O3S and a molecular weight of 377.32 g/mol. Its IUPAC name is methyl (2S)-3,3,3-trifluoro-2-[(4-fluorobenzoyl)amino]-2-(1,3-thiazol-2-ylamino)propanoate.
| Compound Name | methyl (2S)-3,3,3-trifluoro-2-[(4-fluorobenzoyl)amino]-2-(1,3-thiazol-2-ylamino)propanoate |
|---|---|
| PubChem CID | 7300840 |
| Molecular Formula | C14H11F4N3O3S |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | methyl (2S)-3,3,3-trifluoro-2-[(4-fluorobenzoyl)amino]-2-(1,3-thiazol-2-ylamino)propanoate |
| SMILES | COC(=O)[C@](NC(=O)c1ccc(F)cc1)(Nc1nccs1)C(F)(F)F |
| InChI | InChI=1S/C14H11F4N3O3S/c1-24-11(23)13(14(16,17)18,21-12-19-6-7-25-12)20-10(22)8-2-4-9(15)5-3-8/h2-7H,1H3,(H,19,21)(H,20,22)/t13-/m0/s1 |
| InChIKey | JSCGWCQRZPZDGY-ZDUSSCGKSA-N |
| XLogP | 2.56 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|