C16H15ClO5 — CID 567060
7-chloro-6-hydroxy-3'-methoxy-4,5'-dimethylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione (PubChem CID 567060) has the molecular formula C16H15ClO5 and a molecular weight of 322.74 g/mol. Its IUPAC name is 7-chloro-6-hydroxy-3'-methoxy-4,5'-dimethylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione.
| Compound Name | 7-chloro-6-hydroxy-3'-methoxy-4,5'-dimethylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 567060 |
| Molecular Formula | C16H15ClO5 |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 7-chloro-6-hydroxy-3'-methoxy-4,5'-dimethylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
| SMILES | COC1=CC(=O)C2(Oc3c(Cl)c(O)cc(C)c3C2=O)C(C)C1 |
| InChI | InChI=1S/C16H15ClO5/c1-7-4-10(18)13(17)14-12(7)15(20)16(22-14)8(2)5-9(21-3)6-11(16)19/h4,6,8,18H,5H2,1-3H3 |
| InChIKey | YLHPJBSSMMETGY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|