C18H21NO2 — CID 56714153
1-[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]-2-phenylethane-1,2-dione (PubChem CID 56714153) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 56714153 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1-[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]-2-phenylethane-1,2-dione |
| SMILES | C=CCC1(CC=C)CCCN1C(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H21NO2/c1-3-11-18(12-4-2)13-8-14-19(18)17(21)16(20)15-9-6-5-7-10-15/h3-7,9-10H,1-2,8,11-14H2 |
| InChIKey | VATPPMIITZSUOF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|