C14H19N7 — CID 56730368
1-ethyl-N-(3-imidazol-1-ylpropyl)-3-methylpyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 56730368) has the molecular formula C14H19N7 and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-ethyl-N-(3-imidazol-1-ylpropyl)-3-methylpyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 1-ethyl-N-(3-imidazol-1-ylpropyl)-3-methylpyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 56730368 |
| Molecular Formula | C14H19N7 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-ethyl-N-(3-imidazol-1-ylpropyl)-3-methylpyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCn1nc(C)c2ncnc(NCCCn3ccnc3)c21 |
| InChI | InChI=1S/C14H19N7/c1-3-21-13-12(11(2)19-21)17-9-18-14(13)16-5-4-7-20-8-6-15-10-20/h6,8-10H,3-5,7H2,1-2H3,(H,16,17,18) |
| InChIKey | VVXCCJQZPLIKOQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|