C19H25N3O2 — CID 56754565
N-methyl-N-[4-(methylamino)-4-oxobutan-2-yl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 56754565) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-methyl-N-[4-(methylamino)-4-oxobutan-2-yl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-methyl-N-[4-(methylamino)-4-oxobutan-2-yl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 56754565 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N-methyl-N-[4-(methylamino)-4-oxobutan-2-yl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | CNC(=O)CC(C)N(C)C(=O)c1cccc2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C19H25N3O2/c1-12(11-17(23)20-2)22(3)19(24)15-9-6-8-14-13-7-4-5-10-16(13)21-18(14)15/h6,8-9,12,21H,4-5,7,10-11H2,1-3H3,(H,20,23) |
| InChIKey | RKNFQGUPQMKKJD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|