C16H23N3O3S — CID 56756853
3-(2,9-diazaspiro[4.5]decan-2-ylsulfonyl)-N-methylbenzamide (PubChem CID 56756853) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is 3-(2,9-diazaspiro[4.5]decan-2-ylsulfonyl)-N-methylbenzamide.
| Compound Name | 3-(2,9-diazaspiro[4.5]decan-2-ylsulfonyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 56756853 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 3-(2,9-diazaspiro[4.5]decan-2-ylsulfonyl)-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(S(=O)(=O)N2CCC3(CCCNC3)C2)c1 |
| InChI | InChI=1S/C16H23N3O3S/c1-17-15(20)13-4-2-5-14(10-13)23(21,22)19-9-7-16(12-19)6-3-8-18-11-16/h2,4-5,10,18H,3,6-9,11-12H2,1H3,(H,17,20) |
| InChIKey | JBEVOSSDSKHQKS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |