C29H50N2O — CID 56834631
(4aS,5S,8aR)-1,1,4a,6-tetramethyl-5-[[3-methylbut-2-enyl-[4-(3-methylbut-2-enylamino)butyl]amino]methyl]-4,5,8,8a-tetrahydro-3H-naphthalen-2-one (PubChem CID 56834631) has the molecular formula C29H50N2O and a molecular weight of 442.73 g/mol. Its IUPAC name is (4aS,5S,8aR)-1,1,4a,6-tetramethyl-5-[[3-methylbut-2-enyl-[4-(3-methylbut-2-enylamino)butyl]amino]methyl]-4,5,8,8a-tetrahydro-3H-naphthalen-2-one.
| Compound Name | (4aS,5S,8aR)-1,1,4a,6-tetramethyl-5-[[3-methylbut-2-enyl-[4-(3-methylbut-2-enylamino)butyl]amino]methyl]-4,5,8,8a-tetrahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 56834631 |
| Molecular Formula | C29H50N2O |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.39 |
| IUPAC Name | (4aS,5S,8aR)-1,1,4a,6-tetramethyl-5-[[3-methylbut-2-enyl-[4-(3-methylbut-2-enylamino)butyl]amino]methyl]-4,5,8,8a-tetrahydro-3H-naphthalen-2-one |
| SMILES | CC(C)=CCNCCCCN(CC=C(C)C)C[C@H]1C(C)=CC[C@H]2C(C)(C)C(=O)CC[C@]12C |
| InChI | InChI=1S/C29H50N2O/c1-22(2)14-18-30-17-9-10-19-31(20-15-23(3)4)21-25-24(5)11-12-26-28(6,7)27(32)13-16-29(25,26)8/h11,14-15,25-26,30H,9-10,12-13,16-21H2,1-8H3/t25-,26-,29+/m0/s1 |
| InChIKey | KFDJLXAKTXMEBA-QXTIUPHPSA-N |
| XLogP | 6.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|