C24H41NO — CID 56839559
(Z,5E,9E,13E)-N-methoxy-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-imine (PubChem CID 56839559) has the molecular formula C24H41NO and a molecular weight of 359.60 g/mol. Its IUPAC name is (Z,5E,9E,13E)-N-methoxy-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-imine.
| Compound Name | (Z,5E,9E,13E)-N-methoxy-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-imine |
|---|---|
| PubChem CID | 56839559 |
| Molecular Formula | C24H41NO |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.32 |
| IUPAC Name | (Z,5E,9E,13E)-N-methoxy-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-imine |
| SMILES | CO/N=C(/C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H41NO/c1-20(2)12-8-13-21(3)14-9-15-22(4)16-10-17-23(5)18-11-19-24(6)25-26-7/h12,14,16,18H,8-11,13,15,17,19H2,1-7H3/b21-14+,22-16+,23-18+,25-24- |
| InChIKey | UVIYVVDHIFDJOG-MENRIXANSA-N |
| XLogP | 7.93 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|