C9H14O4 — CID 56851489
ethyl (3aS,5R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-carboxylate (PubChem CID 56851489) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is ethyl (3aS,5R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-carboxylate.
| Compound Name | ethyl (3aS,5R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-carboxylate |
|---|---|
| PubChem CID | 56851489 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | ethyl (3aS,5R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H]2CCO[C@@H]2O1 |
| InChI | InChI=1S/C9H14O4/c1-2-11-8(10)7-5-6-3-4-12-9(6)13-7/h6-7,9H,2-5H2,1H3/t6-,7+,9+/m0/s1 |
| InChIKey | OKPQBXNTSGGFKS-LKEWCRSYSA-N |
| XLogP | 0.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |