C24H29FN2O2 — CID 56853318
1-[(4aR,8aR)-1-[(E)-3-(furan-2-yl)-2-methylprop-2-enyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 56853318) has the molecular formula C24H29FN2O2 and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-[(4aR,8aR)-1-[(E)-3-(furan-2-yl)-2-methylprop-2-enyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[(4aR,8aR)-1-[(E)-3-(furan-2-yl)-2-methylprop-2-enyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 56853318 |
| Molecular Formula | C24H29FN2O2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-[(4aR,8aR)-1-[(E)-3-(furan-2-yl)-2-methylprop-2-enyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | C/C(=C\c1ccco1)CN1CCC[C@@H]2CN(C(=O)Cc3ccc(F)cc3)CC[C@H]21 |
| InChI | InChI=1S/C24H29FN2O2/c1-18(14-22-5-3-13-29-22)16-26-11-2-4-20-17-27(12-10-23(20)26)24(28)15-19-6-8-21(25)9-7-19/h3,5-9,13-14,20,23H,2,4,10-12,15-17H2,1H3/b18-14+/t20-,23-/m1/s1 |
| InChIKey | CDIICBHACCCPNY-VDDVWGNKSA-N |
| XLogP | 4.38 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |