C22H28N4O2S — CID 56858878
(7S,9aR)-8-methyl-7-(2-methylpropyl)-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56858878) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is (7S,9aR)-8-methyl-7-(2-methylpropyl)-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-8-methyl-7-(2-methylpropyl)-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56858878 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (7S,9aR)-8-methyl-7-(2-methylpropyl)-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CC(C)C[C@H]1C(=O)N2CCN(Cc3nc(-c4ccccc4)cs3)C[C@@H]2C(=O)N1C |
| InChI | InChI=1S/C22H28N4O2S/c1-15(2)11-18-22(28)26-10-9-25(12-19(26)21(27)24(18)3)13-20-23-17(14-29-20)16-7-5-4-6-8-16/h4-8,14-15,18-19H,9-13H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | VIQYBYPNINRAHM-RBUKOAKNSA-N |
| XLogP | 2.71 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |