C14H15Cl2N3O — CID 56882980
2,4-dichloro-6-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-ylmethyl)phenol (PubChem CID 56882980) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is 2,4-dichloro-6-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-ylmethyl)phenol.
| Compound Name | 2,4-dichloro-6-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-ylmethyl)phenol |
|---|---|
| PubChem CID | 56882980 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2,4-dichloro-6-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-ylmethyl)phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1CN1CCCn2cncc2C1 |
| InChI | InChI=1S/C14H15Cl2N3O/c15-11-4-10(14(20)13(16)5-11)7-18-2-1-3-19-9-17-6-12(19)8-18/h4-6,9,20H,1-3,7-8H2 |
| InChIKey | OBHVOVVIQOATJY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|